Tetrachlorohydroquinone structure
|
Common Name | Tetrachlorohydroquinone | ||
|---|---|---|---|---|
| CAS Number | 87-87-6 | Molecular Weight | 247.89 | |
| Density | 1.848 g/cm3 | Boiling Point | 286.2ºC | |
| Molecular Formula | C6H2Cl4O2 | Melting Point | 238-240 °C | |
| MSDS | N/A | Flash Point | 126.9ºC | |
Use of TetrachlorohydroquinoneTetrachlorohydroquinone (TCHQ) is a metabolite of pentachlorophenol. Tetrachlorohydroquinone increases DNA lesions and induce oxidative stress in rodents[1]. |
| Name | tetrachlorohydroquinone |
|---|---|
| Synonym | More Synonyms |
| Description | Tetrachlorohydroquinone (TCHQ) is a metabolite of pentachlorophenol. Tetrachlorohydroquinone increases DNA lesions and induce oxidative stress in rodents[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.848 g/cm3 |
|---|---|
| Boiling Point | 286.2ºC |
| Melting Point | 238-240 °C |
| Molecular Formula | C6H2Cl4O2 |
| Molecular Weight | 247.89 |
| Flash Point | 126.9ºC |
| Exact Mass | 245.88100 |
| PSA | 40.46000 |
| LogP | 3.71140 |
| Index of Refraction | 1.661 |
| InChIKey | STOSPPMGXZPHKP-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)c(Cl)c(O)c(Cl)c1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | 22-41 |
| Safety Phrases | S26-S36/37/39-S39 |
| RTECS | MX7700000 |
| HS Code | 2908199090 |
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
|
Name: TP_TRANSPORTER: inhibition of Doxorubicin efflux (Doxorubicin: 50 uM, Tetrachlorohydr...
Source: ChEMBL
Target: ATP-dependent translocase ABCB1
External Id: CHEMBL2076599
|
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Spectroscopic Assay from Article 10.1021/bi300261p: "Pentachlorophenol hydroxylase, a...
Source: BindingDB
Target: N/A
External Id: BindingDB_5706_1
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| Tetrachlorohydroquinone |
| EINECS 201-779-1 |
| MFCD00041748 |
| 2,3,5,6-tetrachlorobenzene-1,4-diol |