Hydrolyzed Fumonisin B1 structure
|
Common Name | Hydrolyzed Fumonisin B1 | ||
|---|---|---|---|---|
| CAS Number | 145040-09-1 | Molecular Weight | 405.61200 | |
| Density | 1.051±0.06 g/cm3(Predicted) | Boiling Point | 593.8±50.0 °C(Predicted) | |
| Molecular Formula | C22H47NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Hydrolyzed Fumonisin B1Hydrolyzed Fumonisin B1 (Aminopentol) is the backbone and main hydrolysis product of the mycotoxin fumonisin B1 (FB1), can weakly inhibit ceramide synthase[1]. |
| Name | (2S,3S,5R,10R,12S,14S,15R,16R)-2-amino-12,16-dimethylicosane-3,5,10,14,15-pentol |
|---|---|
| Synonym | More Synonyms |
| Description | Hydrolyzed Fumonisin B1 (Aminopentol) is the backbone and main hydrolysis product of the mycotoxin fumonisin B1 (FB1), can weakly inhibit ceramide synthase[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.051±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 593.8±50.0 °C(Predicted) |
| Molecular Formula | C22H47NO5 |
| Molecular Weight | 405.61200 |
| Exact Mass | 405.34500 |
| PSA | 127.17000 |
| LogP | 3.03150 |
| Vapour Pressure | 1.42E-16mmHg at 25°C |
| InChIKey | UWWVLQOLROBFTD-GADKELDLSA-N |
| SMILES | CCCCC(C)C(O)C(O)CC(C)CC(O)CCCCC(O)CC(O)C(C)N |
| Storage condition | -20°C |
| Aminopentol |
| HFB1 |