2-[N,N-BIS(TRIFLUOROMETHYLSULFONYL)AMINO]PYRIDINE structure
|
Common Name | 2-[N,N-BIS(TRIFLUOROMETHYLSULFONYL)AMINO]PYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 145100-50-1 | Molecular Weight | 358.23800 | |
| Density | 1.832 g/cm3 | Boiling Point | 80-90 °C0.25 mm Hg(lit.) | |
| Molecular Formula | C7H4F6N2O4S2 | Melting Point | 40-42 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(2-Pyridyl)bis(trifluoromethanesulfonimide) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.832 g/cm3 |
|---|---|
| Boiling Point | 80-90 °C0.25 mm Hg(lit.) |
| Melting Point | 40-42 °C(lit.) |
| Molecular Formula | C7H4F6N2O4S2 |
| Molecular Weight | 358.23800 |
| Flash Point | 230 °F |
| Exact Mass | 357.95200 |
| PSA | 101.17000 |
| LogP | 3.74880 |
| Vapour Pressure | 0.00024mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | DXLQEJHUQKKSRB-UHFFFAOYSA-N |
| SMILES | O=S(=O)(N(c1ccccn1)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| Storage condition | Refrigerator (+4°C) |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
|
~84%
2-[N,N-BIS(TRIF... CAS#:145100-50-1 |
| Literature: Comins, Daniel L.; Dehghani, Ali Tetrahedron Letters, 1992 , vol. 33, # 42 p. 6299 - 6302 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
N-(2-Pyridyl) bis (trifluoromethanesulfonimide). Cossy J and Allais F.
e-EROS Encyclopedia of Reagents for Organic Synthesis. , (2007)
|
| 2-[N,N-Bis(trifluoromethylsulfonyl)amino]pyridine |
| N,N-Bis(trifluoromethylsulfonyl)-2-pyridylamine |
| MFCD00191834 |
| 1,1,1-trifluoro-N-pyridin-2-yl-N-(trifluoromethylsulfonyl)methanesulfonamide |
| 2-Pyridyltriflimide |
| 1,1,1-Trifluoro-N-(pyridin-2-yl)-N-((trifluoromethyl)sulfonyl)methanesulfonamide |