Tetrabutylphosphonium hydroxide structure
|
Common Name | Tetrabutylphosphonium hydroxide | ||
|---|---|---|---|---|
| CAS Number | 14518-69-5 | Molecular Weight | 276.438 | |
| Density | 0.989 g/mL at 25 °C | Boiling Point | N/A | |
| Molecular Formula | C16H37OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Tetra-n-Butylphosphonium Hydroxide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.989 g/mL at 25 °C |
|---|---|
| Molecular Formula | C16H37OP |
| Molecular Weight | 276.438 |
| Exact Mass | 276.258209 |
| PSA | 36.65000 |
| LogP | 6.02760 |
| Index of Refraction | n20/D 1.412 |
| InChIKey | DFQPZDGUFQJANM-UHFFFAOYSA-M |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.[OH-] |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3267 8/PG 2 |
| WGK Germany | - |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2931900090 |
|
~%
Tetrabutylphosp... CAS#:14518-69-5 |
| Literature: Journal of Molecular Liquids, , vol. 153, # 2-3 p. 133 - 138 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD00068456 |
| Phosphonium, tetrabutyl-, hydroxide (1:1) |
| tetrabutylphosphanium,hydroxide |
| EINECS 238-528-0 |
| Tetrabutylphosphonium hydroxide |
| Tetra-n-butylphosphonium hydroxide |