(+)-Secoisolariciresinol structure
|
Common Name | (+)-Secoisolariciresinol | ||
|---|---|---|---|---|
| CAS Number | 145265-02-7 | Molecular Weight | 362.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (+)-Secoisolariciresinol(+)-Secoisolariciresinol, a lignan compound, is a (+)-enantiomer of Secoisolariciresinol[1]. |
| Name | (+)-Secoisolariciresinol |
|---|
| Description | (+)-Secoisolariciresinol, a lignan compound, is a (+)-enantiomer of Secoisolariciresinol[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H26O6 |
|---|---|
| Molecular Weight | 362.42 |
| InChIKey | PUETUDUXMCLALY-HZPDHXFCSA-N |
| SMILES | COc1cc(CC(CO)C(CO)Cc2ccc(O)c(OC)c2)ccc1O |
| Hazard Codes | Xi |
|---|