SnAP-TM Reagent structure
|
Common Name | SnAP-TM Reagent | ||
|---|---|---|---|---|
| CAS Number | 1452829-00-3 | Molecular Weight | 380.220 | |
| Density | N/A | Boiling Point | 383.3±52.0 °C at 760 mmHg | |
| Molecular Formula | C15H35NSSn | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 185.6±30.7 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | SnAP TM Reagent |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 383.3±52.0 °C at 760 mmHg |
|---|---|
| Molecular Formula | C15H35NSSn |
| Molecular Weight | 380.220 |
| Flash Point | 185.6±30.7 °C |
| Exact Mass | 381.151215 |
| LogP | 8.53 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| InChIKey | DYBMHPJDHUKXRF-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)CSCCN |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H315-H319-H335-H410 |
| Precautionary Statements | Missing Phrase - N15.00950417-P261-P280-P302 + P352 + P312-P304 + P340 + P312-P403 + P233 |
| RIDADR | UN 2788 6.1 / PGIII |
|
SnAP reagents for the transformation of aldehydes into substituted thiomorpholines--an alternative to cross-coupling with saturated heterocycles.
Angew. Chem. Int. Ed. Engl. 52(6) , 1705-8, (2013)
|
|
|
SnAP reagents for the one-step synthesis of medium-ring saturated N-heterocycles from aldehydes.
Nature Chemistry 6(4) , 310-4, (2014) Interest in saturated N-heterocycles as scaffolds for the synthesis of bioactive molecules is increasing. Reliable and predictable synthetic methods for the preparation of these compounds, especially ... |
|
|
SnAP Reagents for a Cross-Coupling Approach to the One-Step Synthesis of Saturated N-Heterocycles. Luescher MU, et al.
Aldrichimica Acta 48(2) , 43-48, (2015)
|
| MFCD23703162 |
| SnAP TM Reagent |
| 2-{[(Tributylstannyl)methyl]sulfanyl}ethanamine |
| Ethanamine, 2-[[(tributylstannyl)methyl]thio]- |