1,2,3,4-tetrachloro-1,2,3,4,5,5-hexafluorocyclopentane structure
|
Common Name | 1,2,3,4-tetrachloro-1,2,3,4,5,5-hexafluorocyclopentane | ||
|---|---|---|---|---|
| CAS Number | 1453-38-9 | Molecular Weight | 315.85600 | |
| Density | 1.83g/cm3 | Boiling Point | 155ºC at 760mmHg | |
| Molecular Formula | C5Cl4F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 62.3ºC | |
| Name | 1,2,3,4-tetrachloro-1,2,3,4,5,5-hexafluorocyclopentane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.83g/cm3 |
|---|---|
| Boiling Point | 155ºC at 760mmHg |
| Molecular Formula | C5Cl4F6 |
| Molecular Weight | 315.85600 |
| Flash Point | 62.3ºC |
| Exact Mass | 313.86600 |
| LogP | 4.25370 |
| Vapour Pressure | 3.97mmHg at 25°C |
| Index of Refraction | 1.415 |
| InChIKey | SQOAFOCEKCANLU-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(Cl)C(F)(Cl)C(F)(Cl)C1(F)Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2903890090 |
|
~41%
1,2,3,4-tetrach... CAS#:1453-38-9 |
| Literature: Paprott, Gerhard; Lehmann, Sabine; Seppelt, Konrad Chemische Berichte, 1988 , vol. 121, p. 727 - 734 |
|
~%
1,2,3,4-tetrach... CAS#:1453-38-9 |
| Literature: Paprott, Gerhard; Lehmann, Sabine; Seppelt, Konrad Chemische Berichte, 1988 , vol. 121, p. 727 - 734 |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2,3,4,5-Tetrachlor-1,1,2,3,4,5-hexafluorcyclopentan |
| 1,2,3,4-Tetrachlor-hexafluor-cyclopentan |
| PC4801 |