Dicyclohexylboron trifluoromethanesulfonate structure
|
Common Name | Dicyclohexylboron trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 145412-54-0 | Molecular Weight | 326.183 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 337.9±52.0 °C at 760 mmHg | |
| Molecular Formula | C13H22BF3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.1±30.7 °C | |
| Name | Dicyclohexylboron Triflate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.9±52.0 °C at 760 mmHg |
| Molecular Formula | C13H22BF3O3S |
| Molecular Weight | 326.183 |
| Flash Point | 158.1±30.7 °C |
| Exact Mass | 326.133484 |
| PSA | 51.75000 |
| LogP | 5.58 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | FBVDLYBQGQLANQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OB(C1CCCCC1)C1CCCCC1)C(F)(F)F |
| Storage condition | Refrigerator |
|
~79%
Dicyclohexylbor... CAS#:145412-54-0 |
| Literature: Inoue, Tadashi; Liu, Ji-Feng; Buske, Dana C.; Abiko, Atsushi Journal of Organic Chemistry, 2002 , vol. 67, # 15 p. 5250 - 5256 |
|
~%
Dicyclohexylbor... CAS#:145412-54-0 |
| Literature: Journal of Organic Chemistry, , vol. 67, # 15 p. 5250 - 5256 |
|
~%
Dicyclohexylbor... CAS#:145412-54-0 |
| Literature: Tetrahedron Letters, , vol. 42, # 13 p. 2431 - 2434 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| Dicyclohexyl(trifluoroMethanesulfonyloxy)borane |
| Trifluoromethanesulfonic Acid Dicyclohexylboryl Ester |
| Borane, dicyclohexyl[[(trifluoromethyl)sulfonyl]oxy]- |
| MFCD06797094 |
| dicyclohexylboranyl trifluoromethanesulfonate |
| Dicyclohexyl{[(trifluoromethyl)sulfonyl]oxy}borane |