2,4,6-Triisopropylphenylboronic acid methyl ester structure
|
Common Name | 2,4,6-Triisopropylphenylboronic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 145434-22-6 | Molecular Weight | 276.22200 | |
| Density | 0.913 g/mL at 25ºC | Boiling Point | 323.448ºC at 760 mmHg | |
| Molecular Formula | C17H29BO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110ºC | |
| Name | Dimethyl (2,4,6-triisopropylphenyl)boronate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.913 g/mL at 25ºC |
|---|---|
| Boiling Point | 323.448ºC at 760 mmHg |
| Molecular Formula | C17H29BO2 |
| Molecular Weight | 276.22200 |
| Flash Point | 110ºC |
| Exact Mass | 276.22600 |
| PSA | 18.46000 |
| LogP | 4.04480 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | n20/D 1.484 |
| InChIKey | KRQWDHHDTSORLQ-UHFFFAOYSA-N |
| SMILES | COB(OC)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
|
~72%
2,4,6-Triisopro... CAS#:145434-22-6 |
| Literature: Smith, Keith; Pelter, Andrew; Jin, Zhao Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1993 , # 4 p. 395 - 396 |
| dimethoxy-[2,4,6-tri(propan-2-yl)phenyl]borane |