1,3,5-Triisopropylbenzene structure
|
Common Name | 1,3,5-Triisopropylbenzene | ||
|---|---|---|---|---|
| CAS Number | 717-74-8 | Molecular Weight | 204.351 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 238.6±20.0 °C at 760 mmHg | |
| Molecular Formula | C15H24 | Melting Point | -14--11°C | |
| MSDS | N/A | Flash Point | 86.7±0.0 °C | |
Use of 1,3,5-Triisopropylbenzene1,3,5-Triisopropylbenzene acts as a fuel and fuel additive. 1,3,5-Triisopropylbenzene is also used in lubricants and lubricant additives. 1,3,5-Triisopropylbenzene is used as a micelle expander[1]. |
| Name | 1,3,5-Triisopropylbenzene |
|---|---|
| Synonym | More Synonyms |
| Description | 1,3,5-Triisopropylbenzene acts as a fuel and fuel additive. 1,3,5-Triisopropylbenzene is also used in lubricants and lubricant additives. 1,3,5-Triisopropylbenzene is used as a micelle expander[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 238.6±20.0 °C at 760 mmHg |
| Melting Point | -14--11°C |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.351 |
| Flash Point | 86.7±0.0 °C |
| Exact Mass | 204.187805 |
| LogP | 6.24 |
| Vapour Pressure | 0.1±0.2 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | VUMCUSHVMYIRMB-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)cc(C(C)C)c1 |
| Hazard Codes | T+ |
|---|---|
| Safety Phrases | S23-S24/25 |
| WGK Germany | 3 |
| HS Code | 29029080 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| 1,3,5-Tri(propan-2-yl)benzol |
| 2,4,6-triisopropylbenzene |
| Benzene, 1,3,5-triisopropyl- |
| MFCD00008890 |
| EINECS 211-941-3 |
| Benzene, 1,3,5-tris(1-methylethyl)- |
| 1,3,5-tri(propan-2-yl)benzene |
| 1,3,5-Triisopropylbenzene |