2,2'-(2,4,8,10-TETRAOXASPIRO[5.5]UNDECANE-3,9-DIYL)BIS(2-METHYLPROPAN-1-OL) structure
|
Common Name | 2,2'-(2,4,8,10-TETRAOXASPIRO[5.5]UNDECANE-3,9-DIYL)BIS(2-METHYLPROPAN-1-OL) | ||
|---|---|---|---|---|
| CAS Number | 1455-42-1 | Molecular Weight | 304.379 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 434.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H28O6 | Melting Point | 198-200ºC | |
| MSDS | N/A | Flash Point | 216.4±27.3 °C | |
| Name | 3,9-bis(1,1-dimethyl-2-hydroxyethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 434.2±40.0 °C at 760 mmHg |
| Melting Point | 198-200ºC |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.379 |
| Flash Point | 216.4±27.3 °C |
| Exact Mass | 304.188599 |
| PSA | 77.38000 |
| LogP | -0.04 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | BPZIYBJCZRUDEG-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C1OCC2(CO1)COC(C(C)(C)CO)OC2 |
| Hazard Codes | Xn |
|---|---|
| Safety Phrases | S22-S24/25 |
| HS Code | 2932999099 |
|
~88%
2,2'-(2,4,8,10-... CAS#:1455-42-1 |
| Literature: MITSUBISHI GAS CHEMICAL COMPANY, INC. Patent: EP1598357 A1, 2005 ; Location in patent: Page/Page column 8 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-diethanol, β,β,β',β'-tetramethyl- |
| 2-[3-(1-hydroxy-2-methylpropan-2-yl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]-2-methylpropan-1-ol |
| MFCD00059794 |
| 2,2'-(2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-diyl)bis(2-methyl-1-propanol) |
| Bis(hydroxypivalaldehyde) Pentaerythritolacetal Cyclic Acetal |
| 2,2'-(2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-diyl)bis(2-methylpropan-1-ol) |
| 3,9-Bis(1,1-diMethyl-2-hydroxyethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
| 3,9-Bis(1,1-dimethyl-2-hydroxyethyl)-2,4,8,10-tetraoxaspiro |