Pyrrolidine,1-(2,4-dinitrophenyl)- structure
|
Common Name | Pyrrolidine,1-(2,4-dinitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 14552-00-2 | Molecular Weight | 237.21200 | |
| Density | 1.414g/cm3 | Boiling Point | 408.6ºC at 760mmHg | |
| Molecular Formula | C10H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.9ºC | |
| Name | 1-(2,4-dinitrophenyl)pyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 408.6ºC at 760mmHg |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.21200 |
| Flash Point | 200.9ºC |
| Exact Mass | 237.07500 |
| PSA | 94.88000 |
| LogP | 3.21460 |
| Vapour Pressure | 6.94E-07mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | ARCUVLVHQWONDY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Pyrrolidino-2,4-dinitrobenzene |