Benzenamine,4-nitro-N-(triphenylphosphoranylidene)- structure
|
Common Name | Benzenamine,4-nitro-N-(triphenylphosphoranylidene)- | ||
|---|---|---|---|---|
| CAS Number | 14562-02-8 | Molecular Weight | 398.39400 | |
| Density | 1.18g/cm3 | Boiling Point | 574ºC at 760mmHg | |
| Molecular Formula | C24H19N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl)imino-triphenyl-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 574ºC at 760mmHg |
| Molecular Formula | C24H19N2O2P |
| Molecular Weight | 398.39400 |
| Exact Mass | 398.11800 |
| PSA | 67.99000 |
| LogP | 5.92720 |
| Vapour Pressure | 1.39E-12mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | KBLHCHSLVSDURO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| HS Code | 2931900090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| N-p-nitrophenyl-P,P,P-triphenylphosphine imide |
| T0504-7328 |
| Benzenamine,4-nitro-N-(triphenylphosphoranylidene) |
| N-(4-nitrophenyl)triphenyliminophosphorane |
| (4-nitrophenyl)imino-triphenyl |
| (4-nitrophenylimino)triphenylphosphorane |
| p-nitrophenyliminotriphenylphosphorane |
| triphenylphosphine p-nitrophenylimide |
| N-p-nitrophenyltriphenylphosphine imide |