1-(2-Chlorophenyl)-3-methyl-2-pyrazolin-5-one structure
|
Common Name | 1-(2-Chlorophenyl)-3-methyl-2-pyrazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 14580-22-4 | Molecular Weight | 208.64400 | |
| Density | 1.32 g/cm3 | Boiling Point | 361.6ºC at 760 mmHg | |
| Molecular Formula | C10H9ClN2O | Melting Point | 193-197 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 172.5ºC | |
| Name | 1-(2-Chlorophenyl)-3-methyl-2-pyrazolin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32 g/cm3 |
|---|---|
| Boiling Point | 361.6ºC at 760 mmHg |
| Melting Point | 193-197 °C(lit.) |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.64400 |
| Flash Point | 172.5ºC |
| Exact Mass | 208.04000 |
| PSA | 32.67000 |
| LogP | 1.95320 |
| Vapour Pressure | 2.04E-05mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | CWESERWNUIUBJU-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2ccccc2Cl)C(=O)C1 |
|
~%
1-(2-Chlorophen... CAS#:14580-22-4 |
| Literature: Tetrahedron Letters, , vol. 53, # 49 p. 6650 - 6653 |
|
~%
1-(2-Chlorophen... CAS#:14580-22-4 |
| Literature: Australian Journal of Chemistry, , vol. 63, # 5 p. 785 - 791 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-Chlorophenyl)-3-methyl-1H-pyrazol-5(4H)-one |
| 1-(2-Chlorophenyl)-3-methyl-5-pyrazolone Hydrate |
| 2-(2-chlorophenyl)-5-methyl-4H-pyrazol-3-one |
| MFCD00059717 |
| EINECS 238-623-7 |