5,7-DIHYDROXY-3,3',4',5'-TETRAMETHOXYFLAVONE structure
|
Common Name | 5,7-DIHYDROXY-3,3',4',5'-TETRAMETHOXYFLAVONE | ||
|---|---|---|---|---|
| CAS Number | 14585-04-7 | Molecular Weight | 374.34100 | |
| Density | 1.44g/cm3 | Boiling Point | 594.2ºC at 760mmHg | |
| Molecular Formula | C19H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.3ºC | |
| Name | 5,7-dihydroxy-3-methoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 594.2ºC at 760mmHg |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.34100 |
| Flash Point | 214.3ºC |
| Exact Mass | 374.10000 |
| PSA | 107.59000 |
| LogP | 2.90560 |
| Vapour Pressure | 1.02E-14mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | YSXLGTWJLNLXKQ-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc(OC)c1OC |
| HS Code | 2914509090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,7-Dihydroxy-3,3',4',5'-tetramethoxyflavon |
| 5,7-dihydroxy-3,3',4',5'-tetramethoxyflavone |
| 3',3',4',5'-tetra-O-methylmyricetin |
| 5,7-Dihydroxy-3-methoxy-2-(3,4,5-trimethoxy-phenyl)-chromen-4-on |
| 3,3',4',5'-Tetramethyl-myricetin |
| 5,7-dihydroxy-3-methoxy-2-(3,4,5-trimethoxy-phenyl)-chromen-4-one |
| Myricetin 3,3',4',5'-tetramethyl ether |