5,7-Dihydroxy-3',4',5'-trimethoxyflavanone structure
|
Common Name | 5,7-Dihydroxy-3',4',5'-trimethoxyflavanone | ||
|---|---|---|---|---|
| CAS Number | 62252-10-2 | Molecular Weight | 346.33100 | |
| Density | 1.348g/cm3 | Boiling Point | 562.6ºC at 760 mmHg | |
| Molecular Formula | C18H18O7 | Melting Point | 227-230ºC | |
| MSDS | N/A | Flash Point | 205.3ºC | |
| Name | 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 562.6ºC at 760 mmHg |
| Melting Point | 227-230ºC |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.33100 |
| Flash Point | 205.3ºC |
| Exact Mass | 346.10500 |
| PSA | 94.45000 |
| LogP | 2.83010 |
| Index of Refraction | 1.604 |
| InChIKey | CTALFFOVOLJORS-UHFFFAOYSA-N |
| SMILES | COc1cc(C2CC(=O)c3c(O)cc(O)cc3O2)cc(OC)c1OC |
| HS Code | 2932999099 |
|---|
|
~%
5,7-Dihydroxy-3... CAS#:62252-10-2 |
| Literature: Shinoda et al. Yakugaku Zasshi, 1931 , vol. 51, p. 249,252; dtsch. Ref. S. 23 Chem.Abstr., 1931 , p. 3979 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,7-dihydroxy-3',4',5'-trimethylhydroxyflavone |
| 5,7-Dihydroxy-3',4',5'-trimethoxy-flavanon |
| 5,7-OH-3',4',5'-triMeO Flavone |
| 5,7-dihydroxy-3',4',5'-trimethoxyflavanone |