Oosponol structure
|
Common Name | Oosponol | ||
|---|---|---|---|---|
| CAS Number | 146-04-3 | Molecular Weight | 220.18 | |
| Density | 1.547g/cm3 | Boiling Point | 485.9ºC at 760mmHg | |
| Molecular Formula | C11H8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.9ºC | |
Use of OosponolOosponol is a dopamine beta-hydroxylase inhibitor exhibiting hypotensive effects.Oospongol has strong antifungal activity against many antagonistic fungi[1][2]. |
| Name | 8-hydroxy-4-(2-hydroxyacetyl)isochromen-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Oosponol is a dopamine beta-hydroxylase inhibitor exhibiting hypotensive effects.Oospongol has strong antifungal activity against many antagonistic fungi[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.547g/cm3 |
|---|---|
| Boiling Point | 485.9ºC at 760mmHg |
| Molecular Formula | C11H8O5 |
| Molecular Weight | 220.18 |
| Flash Point | 198.9ºC |
| Exact Mass | 220.03700 |
| PSA | 87.74000 |
| LogP | 0.67360 |
| Vapour Pressure | 2.96E-10mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | WRIZJEREXIDJCC-UHFFFAOYSA-N |
| SMILES | O=C(CO)c1coc(=O)c2c(O)cccc12 |
| 4-glycoloyl-8-hydroxy-1H-isochromen-1-one |
| Lezitin=Oosponol |
| Lenzitin |
| 8-Hydroxy-4-(hydroxyacetyl)-1H-2-benzopyran-1-one |
| ISOCOUMARIN,4-GLYCOLYL-8-HYDROXY |
| 8-hydroxy-4-hydroxyacetyl-isochromen-1-one |
| Oosponol |
| 4-Glycolyl-8-hydroxy-isocoumarin |