2-[4-(1,1-dimethylethyl)benzoyl]benzoic acid structure
|
Common Name | 2-[4-(1,1-dimethylethyl)benzoyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 146-81-6 | Molecular Weight | 282.33400 | |
| Density | 1.144g/cm3 | Boiling Point | 462.7ºC at 760mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.8ºC | |
| Name | 2-(4-tert-butylbenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 462.7ºC at 760mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 247.8ºC |
| Exact Mass | 282.12600 |
| PSA | 54.37000 |
| LogP | 3.91330 |
| Vapour Pressure | 2.32E-09mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | KFTGETZSJFJXEO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)c2ccccc2C(=O)O)cc1 |
| HS Code | 2918300090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| einecs 205-680-4 |