2-tert-Butyl-9,10-anthraquinone structure
|
Common Name | 2-tert-Butyl-9,10-anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 84-47-9 | Molecular Weight | 264.318 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 421.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C18H16O2 | Melting Point | 98-100 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 157.5±22.9 °C | |
| Name | 2-tert-Butylanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 421.2±35.0 °C at 760 mmHg |
| Melting Point | 98-100 °C(lit.) |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.318 |
| Flash Point | 157.5±22.9 °C |
| Exact Mass | 264.115021 |
| PSA | 34.14000 |
| LogP | 5.07 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | YTPSFXZMJKMUJE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Polymerization of Methyl Methacrylate Photoinitiated by Anthraquinone and 2-tert-Butylanthraquinone Ledwith, A., G. Ndaalio, and A. R. Taylor
Macromolecules 8(1) , 1-7, (1975)
|
|
|
Liquid chromatographic detection of cardiac glycosides, saccharides and hydrocortisone based on the photoreduction of 2-tert-butylanthraquinone Gandelman, M. S.
Anal. Chim. Acta 155 , 159-171, (1983)
|
| 9,10-Anthracenedione, 2-(1,1-dimethylethyl)- |
| EINECS 201-531-2 |
| 9,10-Anthracenedione, 2- (1,1-dimethylethyl)- |
| 2-(2-Methyl-2-propanyl)-9,10-anthraquinone |
| 2-tert-Butylanthracene-9,10-dione |
| 2-tert-Butyl-9,10-anthraquinone |
| 2-tert-Butylanthracen-9,10-dion |
| MFCD00001232 |