8-Benzyl-2,8-diazaspiro[4.5]decane-1,3-dione structure
|
Common Name | 8-Benzyl-2,8-diazaspiro[4.5]decane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 1463-48-5 | Molecular Weight | 258.31600 | |
| Density | 1.23g/cm3 | Boiling Point | 446.5ºC at 760 mmHg | |
| Molecular Formula | C15H18N2O2 | Melting Point | 189ºC | |
| MSDS | N/A | Flash Point | 223.8ºC | |
| Name | 8-Benzyl-2,8-diazaspiro[4.5]decane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 446.5ºC at 760 mmHg |
| Melting Point | 189ºC |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.31600 |
| Flash Point | 223.8ºC |
| Exact Mass | 258.13700 |
| PSA | 49.41000 |
| LogP | 1.58200 |
| Vapour Pressure | 3.63E-08mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | ZGADWVQZLQNWHP-UHFFFAOYSA-N |
| SMILES | O=C1CC2(CCN(Cc3ccccc3)CC2)C(=O)N1 |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~79%
8-Benzyl-2,8-di... CAS#:1463-48-5 |
| Literature: NOVARTIS AG; NOVARTIS PHARMA GMBH Patent: WO2004/76455 A1, 2004 ; Location in patent: Page 18; 34 ; WO 2004/076455 A1 |
|
~%
8-Benzyl-2,8-di... CAS#:1463-48-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 8, # 14 p. 1851 - 1856 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,8-Diazaspiro[4.5]decane-1,3-dione,8-(phenylmethyl) |
| 8-benzyl-2,8-diazaspiro[4.5]decan-1,3-dione |
| benzyldiazaspirodecanedione |
| 8-benzyl-2,8-diazaspiro[4,5]decane-1,3-dione |