2,5-bis-(Chloromethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene structure
|
Common Name | 2,5-bis-(Chloromethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 146370-52-7 | Molecular Weight | 333.293 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 421.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H26Cl2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 131.0±27.4 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 1,4-bis(chloromethyl)-2-(2-ethylhexoxy)-5-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 421.6±40.0 °C at 760 mmHg |
| Molecular Formula | C17H26Cl2O2 |
| Molecular Weight | 333.293 |
| Flash Point | 131.0±27.4 °C |
| Exact Mass | 332.130981 |
| PSA | 18.46000 |
| LogP | 6.17 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | TXAVEVGYOGQVAN-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COc1cc(CCl)c(OC)cc1CCl |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | 26-27-36/37/39-45 |
| RIDADR | UN 1759 |
| WGK Germany | 3.0 |
| Hazard Class | 6.1 |
| HS Code | 2909309090 |
|
~78%
2,5-bis-(Chloro... CAS#:146370-52-7 |
| Literature: Burn, Paul L.; Kraft, Arno; Baigent, Derek R.; Bradley, Donal D. C.; Brown, Adam R.; Friend, Richard H.; Gymer, Richard W.; Holmes, Andrew B.; Jackson, Roger W. Journal of the American Chemical Society, 1993 , vol. 115, # 22 p. 10117 - 10124 |
|
~%
2,5-bis-(Chloro... CAS#:146370-52-7 |
| Literature: Molecular Crystals and Liquid Crystals, , vol. 459, # 1 p. 141/[421]-153/[433] |
|
~%
2,5-bis-(Chloro... CAS#:146370-52-7 |
| Literature: Journal of the American Chemical Society, , vol. 115, # 22 p. 10117 - 10124 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,5-Bis(chloromethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene |
| 1,4-bis(chloromethyl)-2-methoxy-5-(2-ethylhexyloxy)benzene |
| 2-methoxy-5-(2-ethylhexyloxy)-p-xylylene chloride |
| MFCD03093939 |
| 1,4-bis(chloromethyl)-2-((2-ethylhexyl)oxy)-5-methoxybenzene |
| 2,4-DICHLORO-5-FLUOROPHENYLACETYL CHLORIDE |
| 1,4-bis(chloromethyl)-5-(2-ethylhexyloxy)-2-methoxy-benzene |
| Benzene, 1,4-bis(chloromethyl)-2-[(2-ethylhexyl)oxy]-5-methoxy- |
| 2,5-Bis(Chloromethyl)-4-(2-Ethylhexyloxy)Anisole |
| 1,4-Bis(chloromethyl)-2-[(2-ethylhexyl)oxy]-5-methoxybenzene |