(R)-3-((tert-Butoxycarbonyl)amino)-5-methylhexanoic acid structure
|
Common Name | (R)-3-((tert-Butoxycarbonyl)amino)-5-methylhexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 146398-18-7 | Molecular Weight | 245.315 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 374.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.2±23.2 °C | |
| Name | (R)-3-((tert-Butoxycarbonyl)amino)-5-methylhexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.3±25.0 °C at 760 mmHg |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.315 |
| Flash Point | 180.2±23.2 °C |
| Exact Mass | 245.162704 |
| PSA | 79.12000 |
| LogP | 2.68 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | XRVAMBSTOWHUMM-SECBINFHSA-N |
| SMILES | CC(C)CC(CC(=O)O)NC(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (3R)-5-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)hexanoic acid |
| (3R)-3-[(tert-Butoxycarbonyl)amino]-5-methylhexanoic acid |
| (3R)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| Hexanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-5-methyl-, (3R)- |