CaMaric acid structure
|
Common Name | CaMaric acid | ||
|---|---|---|---|---|
| CAS Number | 146450-83-1 | Molecular Weight | 568.78 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 654.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C35H52O6 | Melting Point | 188-189 °C | |
| MSDS | N/A | Flash Point | 198.9±25.0 °C | |
Use of CaMaric acidCamaric acid can be isolated from the root of Lantana montevidensis and has antibacterial activity[1]. |
| Name | (3α,22β)-3-Hydroxy-22-{[(2Z)-2-methyl-2-butenoyl]oxy}-3,25-epoxyo lean-12-en-28-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Camaric acid can be isolated from the root of Lantana montevidensis and has antibacterial activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 654.7±55.0 °C at 760 mmHg |
| Melting Point | 188-189 °C |
| Molecular Formula | C35H52O6 |
| Molecular Weight | 568.78 |
| Flash Point | 198.9±25.0 °C |
| Exact Mass | 568.376404 |
| PSA | 93.06000 |
| LogP | 8.37 |
| Vapour Pressure | 0.0±4.5 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | RSKOPEQHBSFOLQ-OTHZFUNLSA-N |
| SMILES | CC=C(C)C(=O)OC1CC(C)(C)CC2C3=CCC4C56CCC(O)(OC5)C(C)(C)C6CCC4(C)C3(C)CCC12C(=O)O |
| (3α,22β)-3-Hydroxy-22-{[(2Z)-2-methyl-2-butenoyl]oxy}-3,25-epoxyolean-12-en-28-oic acid |
| Olean-12-en-28-oic acid, 3,25-epoxy-3-hydroxy-22-[[(2Z)-2-methyl-1-oxo-2-buten-1-yl]oxy]-, (3α,22β)- |
| 22-fluorovitamin D3 |