Pralatrexate structure
|
Common Name | Pralatrexate | ||
|---|---|---|---|---|
| CAS Number | 146464-95-1 | Molecular Weight | 477.473 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H23N7O5 | Melting Point | 215 °C(dec.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of PralatrexatePralatrexate(Folotyn) is an antifolate, and structurally a folate analog. Its IC50 is < 300 nM in some cell lines.IC50 Value: < 300 nMTarget: AntifolatePralatrexate is an antifolate (a folate analogue metabolic inhibitor) designed to accumulate preferentially in cancer cells. Based on preclinical studies, researchers believe that Pralatrexate selectively enters cells expressing reduced folate carrier type 1 (RFC-1), a protein that is overexpressed on certain cancer cells compared to normal cells. |
| Name | pralatrexate |
|---|---|
| Synonym | More Synonyms |
| Description | Pralatrexate(Folotyn) is an antifolate, and structurally a folate analog. Its IC50 is < 300 nM in some cell lines.IC50 Value: < 300 nMTarget: AntifolatePralatrexate is an antifolate (a folate analogue metabolic inhibitor) designed to accumulate preferentially in cancer cells. Based on preclinical studies, researchers believe that Pralatrexate selectively enters cells expressing reduced folate carrier type 1 (RFC-1), a protein that is overexpressed on certain cancer cells compared to normal cells. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Melting Point | 215 °C(dec.) |
| Molecular Formula | C23H23N7O5 |
| Molecular Weight | 477.473 |
| Exact Mass | 477.176056 |
| PSA | 207.30000 |
| LogP | 0.23 |
| Index of Refraction | 1.704 |
| InChIKey | OGSBUKJUDHAQEA-WMCAAGNKSA-N |
| SMILES | C#CCC(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1 |
| Hazard Codes | Xi |
|---|
| pralatrexato |
| pralatrexatum |
| 10-Propargyl-10-deazaaminopterin |
| N-{4-[1-(2,4-Diamino-6-pteridinyl)-4-pentyn-2-yl]benzoyl}-L-glutamic acid |
| Folotyn |
| N-{4-[1-(2,4-Diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl}-L-glutamic acid |
| N-(4-(1-((2,4-Diamino-6-pteridinyl)methyl)-3-butynyl)benzoyl)-L-glutamic acid |
| (2S)-2-[[4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl]amino]pentanedioic acid |
| L-Glutamic acid, N-[4-[1-[(2,4-diamino-6-pteridinyl)methyl]-3-butyn-1-yl]benzoyl]- |
| Pralatrexate |