1,2-Bis(diphenylphosphino)ethane nickel(II) chloride structure
|
Common Name | 1,2-Bis(diphenylphosphino)ethane nickel(II) chloride | ||
|---|---|---|---|---|
| CAS Number | 14647-23-5 | Molecular Weight | 528.016 | |
| Density | N/A | Boiling Point | 514.8ºC at 760mmHg | |
| Molecular Formula | C26H24Cl2NiP2 | Melting Point | 263-265 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 281.7ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | 1,2-Bis(diphenylphosphino)ethane nickel(II) chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 514.8ºC at 760mmHg |
|---|---|
| Melting Point | 263-265 °C(lit.) |
| Molecular Formula | C26H24Cl2NiP2 |
| Molecular Weight | 528.016 |
| Flash Point | 281.7ºC |
| Exact Mass | 526.008362 |
| PSA | 27.18000 |
| Vapour Pressure | 3.38E-10mmHg at 25°C |
| InChIKey | XXECWTBMGGXMKP-UHFFFAOYSA-L |
| SMILES | Cl[Ni]Cl.c1ccc(P(CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| Storage condition | Refrigerator |
| Water Solubility | insoluble |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H312-H315-H319-H332-H334-H335-H350 |
| Precautionary Statements | P201-P261-P280-P305 + P351 + P338-P308 + P313 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic |
| Risk Phrases | R45;R20/21/22;R36/37/38;R40;R42/43 |
| Safety Phrases | S53-S22-S26-S36-S45-S52 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
1,2-Bis(dipheny... CAS#:14647-23-5 |
| Literature: Ni: MVol.C2, 8.20, page 1073 - 1085 |
|
~%
1,2-Bis(dipheny... CAS#:14647-23-5 |
| Literature: Ni: MVol.C2, 8.20, page 1073 - 1085 |
|
~%
1,2-Bis(dipheny... CAS#:14647-23-5
1,2-Bis(dipheny... CAS#:14647-23-5 |
| Literature: Journal of the Chemical Society, , p. 3238 - 3241 |
|
~%
1,2-Bis(dipheny... CAS#:14647-23-5
1,2-Bis(dipheny... CAS#:14647-23-5 |
| Literature: Journal of the Chemical Society, , p. 3238 - 3241 |
|
~%
1,2-Bis(dipheny... CAS#:14647-23-5 |
| Literature: Ni: MVol.C2, 8.20, page 1073 - 1085 |
|
~%
1,2-Bis(dipheny... CAS#:14647-23-5 |
| Literature: Ni: MVol.C2, 8.20, page 1073 - 1085 |
|
~%
1,2-Bis(dipheny... CAS#:14647-23-5
1,2-Bis(dipheny... CAS#:14647-23-5 |
| Literature: Journal of the Chemical Society, , p. 3238 - 3241 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| 1,2-Bis(Dip |
| Nickel(2+) chloride ethane-1,2-diylbis(diphenylphosphine) (1:2:1) |
| Dichloro[1,2-bis(diphenylphosphino)ethane]nickel(II) |
| 1,2-Bis(Diphenylphosphino)Ethane Nickel(II) Chloride |
| [1,2-Bis(diphenylphosphino)ethane]nickel(II) Dichloride |
| Dichloronickel - ethane-1,2-diylbis(diphenylphosphine) (1:1) |
| 2-diphenylphosphanylethyl(diphenyl)phosphane,nickel(2+),dichloride |
| 1,2-Ethanediylbis(diphenylphosphine) - dichloronickel (1:1) |
| Nickel(2+) chloride - ethane-1,2-diylbis(diphenylphosphine) (1:2:1) |
| MFCD00013313 |
| phosphine, 1,1'-(1,2-ethanediyl)bis[1,1-diphenyl-, nickel(2+) salt, hydrochloride (1:1:2) |
| [1,2-Bis(diphenylphosphino)ethane]dichloronickel(II) |