Butanedioic acid,2-methyl-3-(phenylmethylene)- structure
|
Common Name | Butanedioic acid,2-methyl-3-(phenylmethylene)- | ||
|---|---|---|---|---|
| CAS Number | 1467-37-4 | Molecular Weight | 220.22100 | |
| Density | 1.3g/cm3 | Boiling Point | 418.6ºC at 760mmHg | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.1ºC | |
| Name | (2E)-2-benzylidene-3-methylbutanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 418.6ºC at 760mmHg |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22100 |
| Flash Point | 221.1ºC |
| Exact Mass | 220.07400 |
| PSA | 74.60000 |
| LogP | 1.87530 |
| Vapour Pressure | 9.32E-08mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | JWJQNWSYPNFNCX-JXMROGBWSA-N |
| SMILES | CC(C(=O)O)C(=Cc1ccccc1)C(=O)O |
|
~%
Butanedioic aci... CAS#:1467-37-4 |
| Literature: Horning; Walker Journal of the American Chemical Society, 1952 , vol. 74, p. 5147,5149 |
|
~%
Butanedioic aci... CAS#:1467-37-4 |
| Literature: El-Abbady; Mousa Canadian Journal of Chemistry, 1965 , vol. 43, p. 928,934 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (+-)-2-((E)-benzylidene)-3-methyl-succinic acid |
| (+-)-2-((E)-Benzyliden)-3-methyl-bernsteinsaeure |