Butanedioic acid,2,3-diacetyl-, 1,4-diethyl ester structure
|
Common Name | Butanedioic acid,2,3-diacetyl-, 1,4-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2049-86-7 | Molecular Weight | 258.26800 | |
| Density | 1.129g/cm3 | Boiling Point | 363.1ºC at 760mmHg | |
| Molecular Formula | C12H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159ºC | |
| Name | diethyl 2,3-diacetylbutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 363.1ºC at 760mmHg |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.26800 |
| Flash Point | 159ºC |
| Exact Mass | 258.11000 |
| PSA | 86.74000 |
| LogP | 0.52300 |
| Vapour Pressure | 1.85E-05mmHg at 25°C |
| Index of Refraction | 1.447 |
| InChIKey | GJEDSIHWCPPJFN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C)=O)C(C(C)=O)C(=O)OCC |
| HS Code | 2918300090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2ovyv1&Diethyl 2,3-diacetylsuccinate |
| diethyl-2,3-acetylsuccinate |
| vo2 |
| v1&AC1L3U89 |
| ethyl 2,3-diacetyl-butanoate |
| 2,3-diacetylbutanoic acid diethyl ester |
| 2,3-diacetyl-Butanedioicacid 1,4-diethylester |
| Butanedioic acid,2,3-diacetyl-,diethyl ester |
| 3,4-dicarbethoxy-2,5-hexanedion |