Carbamothioic acid,dimethyl-, S-(2,4,5-trichlorophenyl) ester (9CI) structure
|
Common Name | Carbamothioic acid,dimethyl-, S-(2,4,5-trichlorophenyl) ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 14672-81-2 | Molecular Weight | 284.59000 | |
| Density | 1.49g/cm3 | Boiling Point | 355.8ºC at 760mmHg | |
| Molecular Formula | C9H8Cl3NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169ºC | |
| Name | S-(2,4,5-trichlorophenyl) N,N-dimethylcarbamothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 355.8ºC at 760mmHg |
| Molecular Formula | C9H8Cl3NOS |
| Molecular Weight | 284.59000 |
| Flash Point | 169ºC |
| Exact Mass | 282.93900 |
| PSA | 45.61000 |
| LogP | 4.42050 |
| Vapour Pressure | 3.06E-05mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | YMFCZAXKYCPQHE-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Sc1cc(Cl)c(Cl)cc1Cl |
|
~%
Carbamothioic a... CAS#:14672-81-2 |
| Literature: Newman,M.S.; Karnes,H.A. Journal of Organic Chemistry, 1966 , vol. 31, p. 3980 - 3984 |
|
~%
Carbamothioic a... CAS#:14672-81-2 |
| Literature: Newman,M.S.; Karnes,H.A. Journal of Organic Chemistry, 1966 , vol. 31, p. 3980 - 3984 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4,5-Trichlorphenyldimethylthiolcarbamat |