2,4,5-trichlorophenol sodium salt structure
|
Common Name | 2,4,5-trichlorophenol sodium salt | ||
|---|---|---|---|---|
| CAS Number | 136-32-3 | Molecular Weight | 219.42800 | |
| Density | 2.01 g/mL at 25 °C(lit.) | Boiling Point | 254.8ºC at 760mmHg | |
| Molecular Formula | C6H2Cl3NaO | Melting Point | °Cd ec.) | |
| MSDS | N/A | Flash Point | 107.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,5-trichlorophenol sodium salt |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.01 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 254.8ºC at 760mmHg |
| Melting Point | °Cd ec.) |
| Molecular Formula | C6H2Cl3NaO |
| Molecular Weight | 219.42800 |
| Flash Point | 107.9ºC |
| Exact Mass | 217.90700 |
| PSA | 23.06000 |
| LogP | 3.79060 |
| Vapour Pressure | 0.0106mmHg at 25°C |
| InChIKey | KWFOMJTYKROHLX-UHFFFAOYSA-M |
| SMILES | [Na+].[O-]c1cc(Cl)c(Cl)cc1Cl |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| preventol1 |
| MFCD00058974 |
| SODIUM TRICHLORPHENATE |
| wellno797a |
| sodium 2,4,5-trichlorophenate |
| Sodium 2,4,5-trichlorophenolate |
| sodium2,4,5-trichlorophenoxide |
| dowicideb |
| trichlorophenol |
| trichlorophenol,sodiumsalt |
| EINECS 205-239-6 |
| 2,4,5-TRICHLOROPHENOL Na SALT |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 2,4,5-trichlorophenol sodium salt? |
| A: Related downstream products(CAS) of 2,4,5-trichlorophenol sodium salt: 14672-81-2;25918-55-2;10345-47-8. |
| Q: What English synonyms does 2,4,5-trichlorophenol sodium salt have? |
| A: English synonyms of 2,4,5-trichlorophenol sodium salt: preventol1, MFCD00058974, SODIUM TRICHLORPHENATE, wellno797a, sodium 2,4,5-trichlorophenate, Sodium 2,4,5-trichlorophenolate, sodium2,4,5-trichlorophenoxide, dowicideb, trichlorophenol, trichlorophenol,sodiumsalt, EINECS 205-239-6, 2,4,5-TRICHLOROPHENOL Na SALT. |
| Q: What is the safety information for 2,4,5-trichlorophenol sodium salt? |
| A: Safety information for 2,4,5-trichlorophenol sodium salt: 26-39-45. |
| Q: What is the CAS number of 2,4,5-trichlorophenol sodium salt? |
| A: CAS number of 2,4,5-trichlorophenol sodium salt is 136-32-3. |
| Q: What is the polar surface area (PSA) of 2,4,5-trichlorophenol sodium salt? |
| A: Polar surface area (PSA) of 2,4,5-trichlorophenol sodium salt is 23.06000. |
| Q: What is the molecular weight of 2,4,5-trichlorophenol sodium salt? |
| A: Molecular weight of 2,4,5-trichlorophenol sodium salt is 219.42800. |
| Q: What is the melting point of 2,4,5-trichlorophenol sodium salt? |
| A: Melting point of 2,4,5-trichlorophenol sodium salt is °Cd ec.). |
| Q: What is the InChIKey of 2,4,5-trichlorophenol sodium salt? |
| A: InChIKey of 2,4,5-trichlorophenol sodium salt is KWFOMJTYKROHLX-UHFFFAOYSA-M. |
| Q: What is the molecular formula of 2,4,5-trichlorophenol sodium salt? |
| A: Molecular formula of 2,4,5-trichlorophenol sodium salt is C6H2Cl3NaO. |
| Q: What is the LogP of 2,4,5-trichlorophenol sodium salt? |
| A: LogP of 2,4,5-trichlorophenol sodium salt is 3.79060. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |