{[2-(Trifluoromethyl)phenyl]methyl}phosphonic acid structure
|
Common Name | {[2-(Trifluoromethyl)phenyl]methyl}phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 146780-16-7 | Molecular Weight | 240.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8F3O3P | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | {[2-(Trifluoromethyl)phenyl]methyl}phosphonic acid |
|---|
| Molecular Formula | C8H8F3O3P |
|---|---|
| Molecular Weight | 240.12 |
| Appearance of Characters | solid |
| InChIKey | LJNXXFOSZJOZKN-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)Cc1ccccc1C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
The modification of indium tin oxide with phosphonic acids: mechanism of binding, tuning of surface properties, and potential for use in organic electronic applications.
Acc. Chem. Res. 45 , 337, (2012) Transparent metal oxides, in particular, indium tin oxide (ITO), are critical transparent contact materials for applications in next-generation organic electronics, including organic light emitting di... |