2H-1,3-Benzoxazine,3,4-dihydro-2-(3-nitrophenyl)- structure
|
Common Name | 2H-1,3-Benzoxazine,3,4-dihydro-2-(3-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 14680-10-5 | Molecular Weight | 256.25700 | |
| Density | 1.285g/cm3 | Boiling Point | 419ºC at 760mmHg | |
| Molecular Formula | C14H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.2ºC | |
| Name | 2-(3-nitrophenyl)-3,4-dihydro-2H-1,3-benzoxazine |
|---|
| Density | 1.285g/cm3 |
|---|---|
| Boiling Point | 419ºC at 760mmHg |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.25700 |
| Flash Point | 207.2ºC |
| Exact Mass | 256.08500 |
| PSA | 67.08000 |
| LogP | 3.62760 |
| Vapour Pressure | 3.14E-07mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | VQUHZNMTQIYVKF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C2NCc3ccccc3O2)c1 |
|
~%
2H-1,3-Benzoxaz... CAS#:14680-10-5 |
| Literature: McDonagh,A.F.; Smith,H.E. Journal of Organic Chemistry, 1968 , vol. 33, # 1 p. 1 - 8 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |