Phenol,3-(dimethylamino)-4-nitro- structure
|
Common Name | Phenol,3-(dimethylamino)-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 14703-80-1 | Molecular Weight | 182.17700 | |
| Density | 1.323g/cm3 | Boiling Point | 359.2ºC at 760mmHg | |
| Molecular Formula | C8H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171ºC | |
| Name | 3-(dimethylamino)-4-nitrophenol |
|---|
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 359.2ºC at 760mmHg |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.17700 |
| Flash Point | 171ºC |
| Exact Mass | 182.06900 |
| PSA | 69.29000 |
| LogP | 1.88960 |
| Vapour Pressure | 1.17E-05mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | ILXXMRNOCMXPAC-UHFFFAOYSA-N |
| SMILES | CN(C)c1cc(O)ccc1[N+](=O)[O-] |
|
~92%
Phenol,3-(dimet... CAS#:14703-80-1 |
| Literature: Menard, Delphine; Niculescu-Duvaz, Ion; Dijkstra, Harmen P.; Niculescu-Duvaz, Dan; Suijkerbuijk, Bart M. J. M.; Zambon, Alfonso; Nourry, Arnaud; Roman, Esteban; Davies, Lawrence; Manne, Helen A.; Friedlos, Frank; Kirk, Ruth; Whittaker, Steven; Gill, Adrian; Taylor, Richard D.; Marais, Richard; Springer, Caroline J. Journal of Medicinal Chemistry, 2009 , vol. 52, # 13 p. 3881 - 3891 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |