acetic acid,[4-(hydroxymethyl)phenyl]methanol
![acetic acid,[4-(hydroxymethyl)phenyl]methanol Structure](https://image.chemsrc.com/caspic/267/14720-70-8.png)
acetic acid,[4-(hydroxymethyl)phenyl]methanol structure
|
Common Name | acetic acid,[4-(hydroxymethyl)phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 14720-70-8 | Molecular Weight | 258.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | acetic acid,[4-(hydroxymethyl)phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18O6 |
|---|---|
| Molecular Weight | 258.26800 |
| Exact Mass | 258.11000 |
| PSA | 115.06000 |
| LogP | 0.85300 |
| InChIKey | AMUSNJQKNUGRRF-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1ccc(COC(C)=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 1 | |
CAS#:589-29-7
CAS#:108-24-7
CAS#:2216-45-7
CAS#:75-36-5
CAS#:106-42-3
CAS#:64-19-7
CAS#:622-47-9
CAS#:127-08-2
CAS#:52010-97-6
CAS#:623-24-5
CAS#:56403-29-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-Benzenedimethanol,diacetate |
| 1,4-Bis-acetoxymethyl-benzol |
| 1,4-bis-acetoxymethyl-benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of acetic acid,[4-(hydroxymethyl)phenyl]methanol? |
| A: Related upstream materials(CAS) of acetic acid,[4-(hydroxymethyl)phenyl]methanol: 589-29-7;108-24-7;2216-45-7;75-36-5;106-42-3;64-19-7;622-47-9;127-08-2;52010-97-6;623-24-5. |
| Q: What is the InChIKey of acetic acid,[4-(hydroxymethyl)phenyl]methanol? |
| A: InChIKey of acetic acid,[4-(hydroxymethyl)phenyl]methanol is AMUSNJQKNUGRRF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 14720-70-8? |
| A: Chinese name of 14720-70-8 is 14720-70-8. |
| Q: What is the English name of acetic acid,[4-(hydroxymethyl)phenyl]methanol? |
| A: The English name of acetic acid,[4-(hydroxymethyl)phenyl]methanol is acetic acid,[4-(hydroxymethyl)phenyl]methanol. |
| Q: What English synonyms does acetic acid,[4-(hydroxymethyl)phenyl]methanol have? |
| A: English synonyms of acetic acid,[4-(hydroxymethyl)phenyl]methanol: 1,4-Benzenedimethanol,diacetate, 1,4-Bis-acetoxymethyl-benzol, 1,4-bis-acetoxymethyl-benzene. |
| Q: What is the molecular formula of acetic acid,[4-(hydroxymethyl)phenyl]methanol? |
| A: Molecular formula of acetic acid,[4-(hydroxymethyl)phenyl]methanol is C12H18O6. |
| Q: What is the polar surface area (PSA) of acetic acid,[4-(hydroxymethyl)phenyl]methanol? |
| A: Polar surface area (PSA) of acetic acid,[4-(hydroxymethyl)phenyl]methanol is 115.06000. |
| Q: What are the downstream products of acetic acid,[4-(hydroxymethyl)phenyl]methanol? |
| A: Related downstream products(CAS) of acetic acid,[4-(hydroxymethyl)phenyl]methanol: 56403-29-3. |
| Q: What is the CAS number of acetic acid,[4-(hydroxymethyl)phenyl]methanol? |
| A: CAS number of acetic acid,[4-(hydroxymethyl)phenyl]methanol is 14720-70-8. |
| Q: What is the LogP of acetic acid,[4-(hydroxymethyl)phenyl]methanol? |
| A: LogP of acetic acid,[4-(hydroxymethyl)phenyl]methanol is 0.85300. |