Benzenesulfonamide,4-chloro-N-(2,5-dichlorophenyl)- structure
|
Common Name | Benzenesulfonamide,4-chloro-N-(2,5-dichlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 14738-06-8 | Molecular Weight | 336.62100 | |
| Density | 1.57g/cm3 | Boiling Point | 445.1ºC at 760mmHg | |
| Molecular Formula | C12H8Cl3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223ºC | |
| Name | 4-chloro-N-(2,5-dichlorophenyl)benzenesulfonamide |
|---|
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 445.1ºC at 760mmHg |
| Molecular Formula | C12H8Cl3NO2S |
| Molecular Weight | 336.62100 |
| Flash Point | 223ºC |
| Exact Mass | 334.93400 |
| PSA | 54.55000 |
| LogP | 5.60140 |
| Vapour Pressure | 4.05E-08mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | LIFCXMXVGPATSI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1cc(Cl)ccc1Cl)c1ccc(Cl)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
Benzenesulfonam... CAS#:14738-06-8 |
| Literature: Bergstrom, Carl P.; Sloan, Charles P.; Lau, Wai-Yu; Smith, David W.; Zheng, Ming; Hansel, Steven B.; Polson, Craig T.; Corsa, Jason A.; Barten, Donna M.; Felsenstein, Kevin M.; Roberts, Susan B. Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 2 p. 464 - 468 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |