(5Z)-5-[(4-chlorophenyl)methylidene]-3-methylimidazolidine-2,4-dione structure
|
Common Name | (5Z)-5-[(4-chlorophenyl)methylidene]-3-methylimidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 14745-12-1 | Molecular Weight | 236.65400 | |
| Density | 1.404g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5Z)-5-[(4-chlorophenyl)methylidene]-3-methylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.404g/cm3 |
|---|---|
| Molecular Formula | C11H9ClN2O2 |
| Molecular Weight | 236.65400 |
| Exact Mass | 236.03500 |
| PSA | 52.90000 |
| LogP | 1.44040 |
| Index of Refraction | 1.647 |
| InChIKey | RKXCUDAPOQQJHP-TWGQIWQCSA-N |
| SMILES | CN1C(=O)NC(=Cc2ccc(Cl)cc2)C1=O |
|
~95%
(5Z)-5-[(4-chlo... CAS#:14745-12-1 |
| Literature: Korohoda, Maria Jolanta Polish Journal of Chemistry, 1981 , vol. 55, # 2 p. 359 - 369 |
|
~%
(5Z)-5-[(4-chlo... CAS#:14745-12-1 |
| Literature: Korohoda, Maria Jolanta Polish Journal of Chemistry, 1981 , vol. 55, # 2 p. 359 - 369 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Methyl-5-<p-chlorbenzyliden>-hydantoin |
| 3-Methyl-5-<4-chlor-benzyliden>-hydantoin |