Naphtho[2,3-d]thiazole-4,9-dione (8CI,9CI) structure
|
Common Name | Naphtho[2,3-d]thiazole-4,9-dione (8CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 14770-63-9 | Molecular Weight | 215.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H5NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzo[f][1,3]benzothiazole-4,9-dione |
|---|
| Molecular Formula | C11H5NO2S |
|---|---|
| Molecular Weight | 215.22800 |
| Exact Mass | 215.00400 |
| PSA | 75.27000 |
| LogP | 1.91850 |
| InChIKey | YSARSOPNCPYXJI-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2scnc21 |
| HS Code | 2934999090 |
|---|
|
~%
Naphtho[2,3-d]t... CAS#:14770-63-9 |
| Literature: Berghot, Moged Ahmed Revue Roumaine de Chimie, 2003 , vol. 48, # 3 p. 197 - 203 |
|
~%
Naphtho[2,3-d]t... CAS#:14770-63-9 |
| Literature: Boggust et al. Journal of the Chemical Society, 1950 , p. 680 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |