Benzoicacid, 4-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-, ethyl ester structure
|
Common Name | Benzoicacid, 4-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 14794-06-0 | Molecular Weight | 245.23100 | |
| Density | 1.328g/cm3 | Boiling Point | 406.1ºC at 760 mmHg | |
| Molecular Formula | C13H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | ethyl 4-(2,5-dioxopyrrol-1-yl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 406.1ºC at 760 mmHg |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23100 |
| Flash Point | 199.4ºC |
| Exact Mass | 245.06900 |
| PSA | 63.68000 |
| LogP | 1.35770 |
| Vapour Pressure | 8.32E-07mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | DISBFDYIBYWYJZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C=CC2=O)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2925190090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| f1265-0506 |