Chloropyrilene structure
|
Common Name | Chloropyrilene | ||
|---|---|---|---|---|
| CAS Number | 148-65-2 | Molecular Weight | 295.83100 | |
| Density | 1.234g/cm3 | Boiling Point | 408.8ºC at 760mmHg | |
| Molecular Formula | C14H18ClN3S | Melting Point | 25°C | |
| MSDS | N/A | Flash Point | 201ºC | |
| Name | N'-[(5-chlorothiophen-2-yl)methyl]-N,N-dimethyl-N'-pyridin-2-ylethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 408.8ºC at 760mmHg |
| Melting Point | 25°C |
| Molecular Formula | C14H18ClN3S |
| Molecular Weight | 295.83100 |
| Flash Point | 201ºC |
| Exact Mass | 295.09100 |
| PSA | 47.61000 |
| LogP | 3.36470 |
| Vapour Pressure | 6.83E-07mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | XAEXSWVTEJHRMH-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(Cc1ccc(Cl)s1)c1ccccn1 |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S26-S36-S24/25 |
| HS Code | 2942000000 |
|
~%
Chloropyrilene CAS#:148-65-2 |
| Literature: Monsanto Chem. Co. Patent: US2581869 , 1947 ; |
|
~%
Chloropyrilene CAS#:148-65-2 |
| Literature: Clark et al. Journal of Organic Chemistry, 1949 , vol. 14, p. 216,220 |
|
~%
Chloropyrilene CAS#:148-65-2 |
| Literature: Monsanto Chem. Co. Patent: US2581869 , 1947 ; |
| HS Code | 2942000000 |
|---|
| Chloromethapyrilene |
| Chloropyrilenum [INN-Latin] |
| Histachlorylene |
| 2-<(5-Chlor-2-thenyl)-(2-dimethylamino-ethyl)-amino>-pyridin |
| CHLOROTHEN |
| Chlorthenylpyramine |
| Chlorpyrilenum |
| Pyrithen |
| N-(5-chloro-[2]thienylmethyl)-N',N'-dimethyl-N-[2]pyridyl-ethylenediamine |
| Chlorothenylpyramine |
| Chloropyrilene |
| N-(5-Chlor-[2]thienylmethyl)-N',N'-dimethyl-N-[2]pyridyl-aethylendiamin |
| Cloropirilenio [INN-Spanish] |