Phenolphthalein monophosphate dicyclohexylammonium salt structure
|
Common Name | Phenolphthalein monophosphate dicyclohexylammonium salt | ||
|---|---|---|---|---|
| CAS Number | 14815-59-9 | Molecular Weight | 596.651 | |
| Density | N/A | Boiling Point | 793.4ºC at 760 mmHg | |
| Molecular Formula | C32H41N2O7P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Cyclohexanaminium 4-(1-(4-hydroxyphenyl)-3-oxo-1,3-dihydroisobenzofuran-1-yl)phenyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 793.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C32H41N2O7P |
| Molecular Weight | 596.651 |
| Exact Mass | 596.265137 |
| PSA | 175.14000 |
| LogP | 7.28220 |
| Vapour Pressure | 1.54E-26mmHg at 25°C |
| InChIKey | STNSWFKTHDXJJO-UHFFFAOYSA-N |
| SMILES | NC1CCCCC1.O=C1OC(c2ccc(O)cc2)(c2ccc(OP(=O)(O)O)cc2)c2ccccc21 |
| Storage condition | 2-8°C |
| Water Solubility | methanol: 10 mg/mL, very slightly hazy, colorless |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932209090 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1(3H)-Isobenzofuranone, 3-(4-hydroxyphenyl)-3-[4-(phosphonooxy)phenyl]-, compd. with cyclohexanamine (1:2) |
| Dicyclohexanaminium 4-[1-(4-hydroxyphenyl)-3-oxo-1,3-dihydro-2-benzofuran-1-yl]phenyl phosphate |
| MFCD00070132 |
| EINECS 238-884-7 |
| Phenolphthalein monophosphate bis(cyclohexylammonium) salt |