Phoxim structure
|
Common Name | Phoxim | ||
|---|---|---|---|---|
| CAS Number | 14816-18-3 | Molecular Weight | 298.298 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 362.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H15N2O3PS | Melting Point | 6.1ºC | |
| MSDS | Chinese USA | Flash Point | 173.0±23.2 °C | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
Use of PhoximPhoxim is an organic phosphorus pesticide and widely applies worldwide for agricultural purposes[1][2]. |
| Name | phoxim |
|---|---|
| Synonym | More Synonyms |
| Description | Phoxim is an organic phosphorus pesticide and widely applies worldwide for agricultural purposes[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 362.5±25.0 °C at 760 mmHg |
| Melting Point | 6.1ºC |
| Molecular Formula | C12H15N2O3PS |
| Molecular Weight | 298.298 |
| Flash Point | 173.0±23.2 °C |
| Exact Mass | 298.054108 |
| PSA | 105.74000 |
| LogP | 4.39 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | ATROHALUCMTWTB-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)ON=C(C#N)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H311-H317-H330-H361f-H410 |
| Precautionary Statements | P201-P260-P273-P280-P304 + P340 + P310-P403 + P233 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R22;R50/53 |
| Safety Phrases | S36-S60-S61 |
| RIDADR | UN 2810 |
| RTECS | MD4740000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2926909050 |
| HS Code | 2926909050 |
|---|---|
| Summary | 2926909050 (e)-o,o-diethyl ((cyano(phenyl)methylene)amino)oxyphosphonothioate |
|
Mechanisms of organophosphate resistance in a field population of oriental migratory locust, Locusta migratoria manilensis (Meyen).
Arch. Insect Biochem. Physiol. 71(1) , 3-15, (2009) The susceptibilities to three organophosphate (OP) insecticides (malathion, chlorpyrifos, and phoxim), responses to three metabolic synergists [triphenyl phosphate (TPP), piperonyl butoxide (PBO), and... |
|
|
Cerium chloride improves protein and carbohydrate metabolism of fifth-instar larvae of Bombyx mori under phoxim toxicity.
Biol. Trace Elem. Res. 150(1-3) , 214-20, (2012) The organophosphorus pesticide poisoning of the silkworm Bombyx mori is one of the major events causing serious damage to sericulture. Added low-dose rare earths are demonstrated to increase resistanc... |
|
|
Investigation of photodegradation and hydrolysis of selected substituted urea and organophosphate pesticides in water.
Environ. Sci. Pollut. Res. Int. 18(6) , 949-57, (2011) Photodegradation and hydrolysis of two substituted urea herbicides, monolinuron [3-(4-chlorophenyl)-1-methoxy-1-methylurea] and linuron [3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea], and one organop... |
| Caswell No. 902L |
| MFCD05863734 |
| Volaton |
| Valexone |
| O,O-diethyl ({[(Ξ)-cyano(phenyl)methylidene]amino}oxy)phosphonothioate |
| Valexon |
| Foxima [INN-Spanish] |
| (Z)-N-diethoxyphosphinothioyloxybenzenecarboximidoyl cyanide |
| Phoxim [INN:BAN] |
| Baythion |
| O,O-diethyl-cyanobenzylideneamino-oxyphosphonothioate |
| 4-ethoxy-7-phenyl-3,5-dioxa-6-aza-4-phosphaoct-6-ene-8-nitrile 4-sulfide |
| O,O-diethyl α-cyanobenzylideneaminooxyphosphonothioate |
| PHOXIM |
| EINECS 238-887-3 |
| (EZ)-2-(diethoxyphosphinothioyloxyimino)-2-phenylacetonitrile |
| Phoxime |
| Phoxim [BSI:ISO] |