(3-METHOXY-BENZYL)-(4-METHOXY-BENZYL)-AMINE structure
|
Common Name | (3-METHOXY-BENZYL)-(4-METHOXY-BENZYL)-AMINE | ||
|---|---|---|---|---|
| CAS Number | 148235-02-3 | Molecular Weight | 257.32800 | |
| Density | 1.073g/cm3 | Boiling Point | 384.1ºC at 760 mmHg | |
| Molecular Formula | C16H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.7ºC | |
| Name | 1-(4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]methanamine |
|---|
| Density | 1.073g/cm3 |
|---|---|
| Boiling Point | 384.1ºC at 760 mmHg |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.32800 |
| Flash Point | 160.7ºC |
| Exact Mass | 257.14200 |
| PSA | 30.49000 |
| LogP | 3.38450 |
| Vapour Pressure | 4.19E-06mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | DREJPPMSQIJNBY-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNCc2cccc(OC)c2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |