1H-Indene-1,3(2H)-dione,2-(2-oxo-2-phenylethyl)-2-phenyl- structure
|
Common Name | 1H-Indene-1,3(2H)-dione,2-(2-oxo-2-phenylethyl)-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1483-71-2 | Molecular Weight | 340.37100 | |
| Density | 1.255g/cm3 | Boiling Point | 545.5ºC at 760mmHg | |
| Molecular Formula | C23H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.1ºC | |
| Name | 2-phenacyl-2-phenylindene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 545.5ºC at 760mmHg |
| Molecular Formula | C23H16O3 |
| Molecular Weight | 340.37100 |
| Flash Point | 236.1ºC |
| Exact Mass | 340.11000 |
| PSA | 51.21000 |
| LogP | 4.27660 |
| Vapour Pressure | 5.87E-12mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | RMDJHCGTHAGOQD-UHFFFAOYSA-N |
| SMILES | O=C(CC1(c2ccccc2)C(=O)c2ccccc2C1=O)c1ccccc1 |
|
~%
1H-Indene-1,3(2... CAS#:1483-71-2 |
| Literature: Beringer,F.M.; Galton,S.A. Journal of Organic Chemistry, 1965 , vol. 30, p. 1930 - 1934 |
|
~%
1H-Indene-1,3(2... CAS#:1483-71-2 |
| Literature: Beringer,F.M.; Galton,S.A. Journal of Organic Chemistry, 1965 , vol. 30, p. 1930 - 1934 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Phenyl-2-phenacyl-indandion-(1.3) |
| AmbscL19/LTRi-427 |
| 2-Phenyl-2-phenacyl-1,3-indandion |
| 2-(2-oxo-2-phenylethyl)-2-phenyl-1h-indene-1,3(2h)-dione |