Fradafiban structure
|
Common Name | Fradafiban | ||
|---|---|---|---|---|
| CAS Number | 148396-36-5 | Molecular Weight | 367.39800 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H21N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FradafibanFradafiban is a nonpeptide platelet glycoprotein IIb/IIIa antagonist, which binds to the human platelet GP IIb/IIIa complex with a Kd value of 148 nM. |
| Name | 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fradafiban is a nonpeptide platelet glycoprotein IIb/IIIa antagonist, which binds to the human platelet GP IIb/IIIa complex with a Kd value of 148 nM. |
|---|---|
| Related Catalog | |
| Target |
Kd: 148 nM (human platelet GP IIb/IIIa complex)[1] |
| In Vitro | Fradafiban is a nonpeptide mimetic of the arginine-glycine-aspartic acid recognition sequence. Fradafiban binds with high affinity and selectivity to the human platelet GP IIb/IIIa complex and potently inhibits human platelet aggregation in vitro. Fradafiban reversibly binds to the human platelet GP IIb/IIIa complex with a Kd value of 148 nM[1]. |
| In Vivo | Fradafiban has only very limited oral activity probably due to its high polarity and thus poor absorption after oral ingestion[1]. |
| References |
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.39800 |
| Exact Mass | 367.15300 |
| PSA | 125.50000 |
| LogP | 3.12470 |
| Index of Refraction | 1.659 |
| InChIKey | IKZACQMAVUIGPY-HOTGVXAUSA-N |
| SMILES | N=C(N)c1ccc(-c2ccc(OCC3CC(CC(=O)O)C(=O)N3)cc2)cc1 |
| Storage condition | 2-8℃ |
| UNII-DQ0H2B8YKN |
| C20H21N3O4 |
| fradafibanum |
| Fradafiban |