4-ethyl-1,2-diphenylpyrazolidine-3,5-dione
Modify Date: 2025-08-27 09:11:43
4-ethyl-1,2-diphenylpyrazolidine-3,5-dione structure
|
Common Name | 4-ethyl-1,2-diphenylpyrazolidine-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 14845-06-8 | Molecular Weight | 280.32100 | |
| Density | 1.219g/cm3 | Boiling Point | 399ºC at 760 mmHg | |
| Molecular Formula | C17H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.2ºC | |
| Name | 4-ethyl-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 399ºC at 760 mmHg |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.32100 |
| Flash Point | 168.2ºC |
| Exact Mass | 280.12100 |
| PSA | 40.62000 |
| LogP | 3.13760 |
| Vapour Pressure | 1.42E-06mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | BZURJIFHGLBOSK-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
|
~%
4-ethyl-1,2-dip... CAS#:14845-06-8 |
| Literature: Mukherjee et al. Journal of the Indian Chemical Society, 1953 , vol. 30, p. 841,842 |
|
~%
4-ethyl-1,2-dip... CAS#:14845-06-8 |
| Literature: Denss Experientia, 1959 , vol. 15, p. 95 |
| 1,2-Diphenyl-3,5-dioxo-4-aethylpyrazolidin |
| 1,2-Diphenyl-4-ethyl-3,5-pyrazolidinedione |
| 4-Aethyl-1,2-diphenyl-pyrazolidin-3,5-dion |
| 4-ethyl-1,2-diphenyl-pyrazolidine-3,5-dione |
| 1,2-Diphenyl-3,5-dioxo-4-ethylpyrazolidin |
| 1,2-Diphenyl-4-ethylpyrazolidin-3,5-dion |
| 3,5-Pyrazolidinedione,1,2-diphenyl-4-ethyl |