1,2-Diphenyl-pyrazolidine-3,5-dione structure
|
Common Name | 1,2-Diphenyl-pyrazolidine-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 2652-77-9 | Molecular Weight | 252.26800 | |
| Density | 1.312 g/cm3 | Boiling Point | 380.5ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O2 | Melting Point | 180-183ºC | |
| MSDS | N/A | Flash Point | 167.2ºC | |
| Name | 1,2-diphenyl-pyrazolidine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.312 g/cm3 |
|---|---|
| Boiling Point | 380.5ºC at 760 mmHg |
| Melting Point | 180-183ºC |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.26800 |
| Flash Point | 167.2ºC |
| Exact Mass | 252.09000 |
| PSA | 40.62000 |
| LogP | 2.50150 |
| Vapour Pressure | 5.41E-06mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | XDPKQGKEOCYMQC-UHFFFAOYSA-N |
| SMILES | O=C1CC(=O)N(c2ccccc2)N1c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2933990090 |
|---|
|
~77%
1,2-Diphenyl-py... CAS#:2652-77-9 |
| Literature: Fernandez, Israel; Dyker, C. Adam; DeHope, Alan; Donnadieu, Bruno; Frenking, Gernot; Bertrand, Guy Journal of the American Chemical Society, 2009 , vol. 131, # 33 p. 11875 - 11881 |
|
~58%
1,2-Diphenyl-py... CAS#:2652-77-9 |
| Literature: Fuji Photo Film Co., Ltd. Patent: US6458474 B1, 2002 ; |
|
~%
1,2-Diphenyl-py... CAS#:2652-77-9 |
| Literature: Tsumaki Bulletin of the Chemical Society of Japan, 1931 , vol. 6, p. 1,8 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-diphenyl-5-pyrazolidinedione |
| 1,2-Diphenyl-pyrrazolidin-3,5-dion |
| 1,2-Diphenylpyrazolidine-3,5-dione |
| 1,2-diphenyl-3,5-dioxopyrazolidine |
| 1,2-Diphenyl-3,5-pyrazolidinedione |
| da339 |
| 1,2-diphenyl-3,5-dioxopyrazolidin |
| diphenyldiketopyrazolidine |
| 1,2-Diphenyl-3,5-pyrazolidindion |
| 1,2-Diphenyl-pyrazolidin-3,5-dion |
| difenildichetopirazolidina |
| AURORA KA-3848 |