Thymidine13C10,15N2 5′-monophosphate sodium salt structure
|
Common Name | Thymidine13C10,15N2 5′-monophosphate sodium salt | ||
|---|---|---|---|---|
| CAS Number | 1485539-28-3 | Molecular Weight | 378.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | 13C10H1315N2Na2O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thymidine13C10,15N2 5′-monophosphate sodium saltThymidine-5'-monophosphate-13C10,15N2 (disodium) is the 13C and 15N labeled Thymidine-5'-monophosphate disodium salt[1]. Thymidine-5'-monophosphate disodium salt is an endogenous metabolite. |
| Name | Thymidine-5'-monophosphate-13C10,15N2 disodium |
|---|
| Description | Thymidine-5'-monophosphate-13C10,15N2 (disodium) is the 13C and 15N labeled Thymidine-5'-monophosphate disodium salt[1]. Thymidine-5'-monophosphate disodium salt is an endogenous metabolite. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | 13C10H1315N2Na2O8P |
|---|---|
| Molecular Weight | 378.09 |
| InChIKey | AGSQMPPRYZYDFV-XQKKEPRHSA-L |
| SMILES | Cc1cn(C2CC(O)C(COP(=O)([O-])[O-])O2)c(=O)[nH]c1=O.[Na+].[Na+] |