Palladium,dichlorobis(pyridine)
Palladium,dichlorobis(pyridine) structure
|
Common Name | Palladium,dichlorobis(pyridine) | ||
|---|---|---|---|---|
| CAS Number | 14872-20-9 | Molecular Weight | 335.52600 | |
| Density | N/A | Boiling Point | 106.4ºC at 760mmHg | |
| Molecular Formula | C10H10Cl2N2Pd | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 4.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dichlorobis(Pyridine)Palladium(II) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 106.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H10Cl2N2Pd |
| Molecular Weight | 335.52600 |
| Flash Point | 4.4ºC |
| Exact Mass | 333.92600 |
| PSA | 25.78000 |
| LogP | 3.54220 |
| Vapour Pressure | 22.8mmHg at 25°C |
| InChIKey | NAJDBPACANOPMA-UHFFFAOYSA-L |
| SMILES | Cl[Pd]Cl.c1ccncc1.c1ccncc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 20/21/22 |
| Safety Phrases | 22-36/37/39 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dichlorobis(pyridine)palladium(II) |
| MFCD00792248 |
| dichloropalladium,piperidin-1-ide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of Dichlorobis(Pyridine)Palladium(II)? |
| A: LogP of Dichlorobis(Pyridine)Palladium(II) is 3.54220. |
| Q: What is the CAS number of Dichlorobis(Pyridine)Palladium(II)? |
| A: CAS number of Dichlorobis(Pyridine)Palladium(II) is 14872-20-9. |
| Q: What is the polar surface area (PSA) of Dichlorobis(Pyridine)Palladium(II)? |
| A: Polar surface area (PSA) of Dichlorobis(Pyridine)Palladium(II) is 25.78000. |
| Q: What is the molecular formula of Dichlorobis(Pyridine)Palladium(II)? |
| A: Molecular formula of Dichlorobis(Pyridine)Palladium(II) is C10H10Cl2N2Pd. |
| Q: What is the molecular weight of Dichlorobis(Pyridine)Palladium(II)? |
| A: Molecular weight of Dichlorobis(Pyridine)Palladium(II) is 335.52600. |
| Q: What is the InChIKey of Dichlorobis(Pyridine)Palladium(II)? |
| A: InChIKey of Dichlorobis(Pyridine)Palladium(II) is NAJDBPACANOPMA-UHFFFAOYSA-L. |
| Q: What is the SMILES notation of Dichlorobis(Pyridine)Palladium(II)? |
| A: SMILES notation of Dichlorobis(Pyridine)Palladium(II) is Cl[Pd]Cl.c1ccncc1.c1ccncc1. |
| Q: What is the English name of Dichlorobis(Pyridine)Palladium(II)? |
| A: The English name of Dichlorobis(Pyridine)Palladium(II) is Dichlorobis(Pyridine)Palladium(II). |
| Q: What is the safety information for Dichlorobis(Pyridine)Palladium(II)? |
| A: Safety information for Dichlorobis(Pyridine)Palladium(II): 22-36/37/39. |
| Q: What English synonyms does Dichlorobis(Pyridine)Palladium(II) have? |
| A: English synonyms of Dichlorobis(Pyridine)Palladium(II): Dichlorobis(pyridine)palladium(II), MFCD00792248, dichloropalladium,piperidin-1-ide. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |