Guretolimod structure
|
Common Name | Guretolimod | ||
|---|---|---|---|---|
| CAS Number | 1488364-57-3 | Molecular Weight | 513.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H34F3N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GuretolimodGuretolimod is a Toll-like receptor 7 (TLR7) agonist[1]. |
| Name | Guretolimod |
|---|
| Description | Guretolimod is a Toll-like receptor 7 (TLR7) agonist[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Hori, Seiji, et, al.Preparation of carboxylic acid compounds as TLR-7 agonists.WO2013172479A1 |
| Molecular Formula | C24H34F3N5O4 |
|---|---|
| Molecular Weight | 513.55 |
| InChIKey | XWGKZKKNJOQUSG-SFHVURJKSA-N |
| SMILES | CCCC(CCO)Nc1nc(N)nc(C)c1Cc1ccc(CN(CC(=O)O)CC(F)(F)F)cc1OC |
| Storage condition | -20°C |