bis(2,3,4,5,6-pentafluorophenyl)-phenylborane structure
|
Common Name | bis(2,3,4,5,6-pentafluorophenyl)-phenylborane | ||
|---|---|---|---|---|
| CAS Number | 148892-98-2 | Molecular Weight | 422.02700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H5BF10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(2,3,4,5,6-pentafluorophenyl)-phenylborane |
|---|
| Molecular Formula | C18H5BF10 |
|---|---|
| Molecular Weight | 422.02700 |
| Exact Mass | 422.03200 |
| LogP | 3.59380 |
| InChIKey | PCGYNXNSBCFBSU-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(B(c2ccccc2)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
|
~31%
bis(2,3,4,5,6-p... CAS#:148892-98-2 |
| Literature: Deck, Paul A.; Beswick, Colin L.; Marks, Tobin J. Journal of the American Chemical Society, 1998 , vol. 120, # 8 p. 1772 - 1784 |
|
~54%
bis(2,3,4,5,6-p... CAS#:148892-98-2 |
| Literature: Sundararaman, Anand; Jaekle, Frieder Journal of Organometallic Chemistry, 2003 , vol. 681, # 1-2 p. 134 - 142 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |