bis(2,3,4,5,6-pentafluorophenyl)mercury structure
|
Common Name | bis(2,3,4,5,6-pentafluorophenyl)mercury | ||
|---|---|---|---|---|
| CAS Number | 973-17-1 | Molecular Weight | 534.70200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12F10Hg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(2,3,4,5,6-pentafluorophenyl)mercury |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12F10Hg |
|---|---|
| Molecular Weight | 534.70200 |
| Exact Mass | 535.95500 |
| LogP | 3.11090 |
| InChIKey | UAYZCFIZMZPZOZ-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c([Hg]c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| HS Code | 2931900090 |
|---|
| Precursor 6 | |
|---|---|
| DownStream 6 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (Pentafluorophenyl)mercury |
| bis(pentafluorophenyl)mercury(II) |
| Bis(pentafluorophenyl)mercurate |
| Mercury,bis(pentafluorophenyl) |
| Bis-<pentafluorphenyl>-quecksilber |
| Perfluorodiphenylmercury |
| bis(pentafluorophenyl) mercury |